C27H25F3N2O5S — CID 46074019
ethyl 1-[3-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-4-carboxylate (PubChem CID 46074019) has the molecular formula C27H25F3N2O5S and a molecular weight of 546.57 g/mol. Its IUPAC name is ethyl 1-[3-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46074019 |
| Molecular Formula | C27H25F3N2O5S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | ethyl 1-[3-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccc(/C=C3\SC(=O)N(Cc4ccc(C(F)(F)F)cc4)C3=O)c2)CC1 |
| InChI | InChI=1S/C27H25F3N2O5S/c1-2-37-25(35)19-10-12-31(13-11-19)23(33)20-5-3-4-18(14-20)15-22-24(34)32(26(36)38-22)16-17-6-8-21(9-7-17)27(28,29)30/h3-9,14-15,19H,2,10-13,16H2,1H3/b22-15- |
| InChIKey | KHTQJFPFQJVPBN-JCMHNJIXSA-N |
| XLogP | 5.36 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|