C26H25FN2O5S — CID 93002142
ethyl (3S)-1-[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate (PubChem CID 93002142) has the molecular formula C26H25FN2O5S and a molecular weight of 496.56 g/mol. Its IUPAC name is ethyl (3S)-1-[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93002142 |
| Molecular Formula | C26H25FN2O5S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | ethyl (3S)-1-[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2ccc(/C=C3\SC(=O)N(Cc4ccc(F)cc4)C3=O)cc2)C1 |
| InChI | InChI=1S/C26H25FN2O5S/c1-2-34-25(32)20-4-3-13-28(16-20)23(30)19-9-5-17(6-10-19)14-22-24(31)29(26(33)35-22)15-18-7-11-21(27)12-8-18/h5-12,14,20H,2-4,13,15-16H2,1H3/b22-14-/t20-/m0/s1 |
| InChIKey | OFPSAFGIZLWSCL-ALFKQNEGSA-N |
| XLogP | 4.48 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|