C31H29ClN2O5 — CID 98363009
ethyl (3S)-1-[4-[(E)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoyl]piperidine-3-carboxylate (PubChem CID 98363009) has the molecular formula C31H29ClN2O5 and a molecular weight of 545.04 g/mol. Its IUPAC name is ethyl (3S)-1-[4-[(E)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-[(E)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98363009 |
| Molecular Formula | C31H29ClN2O5 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | ethyl (3S)-1-[4-[(E)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2ccc(/C=C3/Oc4ccccc4N(Cc4ccc(Cl)cc4)C3=O)cc2)C1 |
| InChI | InChI=1S/C31H29ClN2O5/c1-2-38-31(37)24-6-5-17-33(20-24)29(35)23-13-9-21(10-14-23)18-28-30(36)34(19-22-11-15-25(32)16-12-22)26-7-3-4-8-27(26)39-28/h3-4,7-16,18,24H,2,5-6,17,19-20H2,1H3/b28-18+/t24-/m0/s1 |
| InChIKey | OEGRCLUEUQPHTF-USMPFQSLSA-N |
| XLogP | 5.72 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|