C30H29ClN2O3 — CID 46373751
4-[(Z)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(4-methylcyclohexyl)benzamide (PubChem CID 46373751) has the molecular formula C30H29ClN2O3 and a molecular weight of 501.03 g/mol. Its IUPAC name is 4-[(Z)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 4-[(Z)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 46373751 |
| Molecular Formula | C30H29ClN2O3 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-[(Z)-[4-[(4-chlorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(4-methylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(/C=C3\Oc4ccccc4N(Cc4ccc(Cl)cc4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C30H29ClN2O3/c1-20-6-16-25(17-7-20)32-29(34)23-12-8-21(9-13-23)18-28-30(35)33(19-22-10-14-24(31)15-11-22)26-4-2-3-5-27(26)36-28/h2-5,8-15,18,20,25H,6-7,16-17,19H2,1H3,(H,32,34)/b28-18- |
| InChIKey | GKIGSPGUBIVJRV-VEILYXNESA-N |
| XLogP | 6.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|