C30H22ClFN2O3 — CID 46249920
N-[(4-chlorophenyl)methyl]-4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 46249920) has the molecular formula C30H22ClFN2O3 and a molecular weight of 512.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46249920 |
| Molecular Formula | C30H22ClFN2O3 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(/C=C2\Oc3ccccc3N(Cc3cccc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H22ClFN2O3/c31-24-14-10-21(11-15-24)18-33-29(35)23-12-8-20(9-13-23)17-28-30(36)34(19-22-4-3-5-25(32)16-22)26-6-1-2-7-27(26)37-28/h1-17H,18-19H2,(H,33,35)/b28-17- |
| InChIKey | LQFYDFMZVYCZKO-QRQIAZFYSA-N |
| XLogP | 6.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|