C23H16FNO4 — CID 3665015
4-[[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoic acid (PubChem CID 3665015) has the molecular formula C23H16FNO4 and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoic acid.
| Compound Name | 4-[[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 3665015 |
| Molecular Formula | C23H16FNO4 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-[[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C2Oc3ccccc3N(Cc3cccc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H16FNO4/c24-18-5-3-4-16(12-18)14-25-19-6-1-2-7-20(19)29-21(22(25)26)13-15-8-10-17(11-9-15)23(27)28/h1-13H,14H2,(H,27,28) |
| InChIKey | ACXJVAZSULCSDS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|