C31H26N2O3 — CID 46373336
N-benzyl-4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 46373336) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-benzyl-4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-benzyl-4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46373336 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-benzyl-4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1ccc(CN2C(=O)/C(=C\c3ccc(C(=O)NCc4ccccc4)cc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-22-11-13-25(14-12-22)21-33-27-9-5-6-10-28(27)36-29(31(33)35)19-23-15-17-26(18-16-23)30(34)32-20-24-7-3-2-4-8-24/h2-19H,20-21H2,1H3,(H,32,34)/b29-19+ |
| InChIKey | HHRHTYYUBRQEEN-VUTHCHCSSA-N |
| XLogP | 5.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|