C32H34N2O3 — CID 4253397
N-(2,3-dimethylcyclohexyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 4253397) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 4253397 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1ccc(CN2C(=O)C(=Cc3ccc(C(=O)NC4CCCC(C)C4C)cc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-21-11-13-25(14-12-21)20-34-28-9-4-5-10-29(28)37-30(32(34)36)19-24-15-17-26(18-16-24)31(35)33-27-8-6-7-22(2)23(27)3/h4-5,9-19,22-23,27H,6-8,20H2,1-3H3,(H,33,35) |
| InChIKey | JUPHELJBPMUPON-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|