C31H31FN2O2S — CID 92657037
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 92657037) has the molecular formula C31H31FN2O2S and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 92657037 |
| Molecular Formula | C31H31FN2O2S |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H31FN2O2S/c1-20-6-5-7-26(21(20)2)33-30(35)24-14-10-22(11-15-24)18-29-31(36)34(19-23-12-16-25(32)17-13-23)27-8-3-4-9-28(27)37-29/h3-4,8-18,20-21,26H,5-7,19H2,1-2H3,(H,33,35)/b29-18-/t20-,21-,26-/m1/s1 |
| InChIKey | VISFQNDDSYOSHS-RVUOCUMFSA-N |
| XLogP | 7.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|