C30H29FN2O2S — CID 6154457
(2Z)-2-benzylidene-4-[(4-fluorophenyl)methyl]-N-(4-methylcyclohexyl)-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 6154457) has the molecular formula C30H29FN2O2S and a molecular weight of 500.64 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4-[(4-fluorophenyl)methyl]-N-(4-methylcyclohexyl)-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-4-[(4-fluorophenyl)methyl]-N-(4-methylcyclohexyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6154457 |
| Molecular Formula | C30H29FN2O2S |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (2Z)-2-benzylidene-4-[(4-fluorophenyl)methyl]-N-(4-methylcyclohexyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | CC1CCC(NC(=O)c2ccc3c(c2)N(Cc2ccc(F)cc2)C(=O)/C(=C/c2ccccc2)S3)CC1 |
| InChI | InChI=1S/C30H29FN2O2S/c1-20-7-14-25(15-8-20)32-29(34)23-11-16-27-26(18-23)33(19-22-9-12-24(31)13-10-22)30(35)28(36-27)17-21-5-3-2-4-6-21/h2-6,9-13,16-18,20,25H,7-8,14-15,19H2,1H3,(H,32,34)/b28-17- |
| InChIKey | OQNXFZAXDINMSI-QRQIAZFYSA-N |
| XLogP | 6.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|