C28H25FN2O2S — CID 4576350
2-benzylidene-4-[(4-fluorophenyl)methyl]-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one (PubChem CID 4576350) has the molecular formula C28H25FN2O2S and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-benzylidene-4-[(4-fluorophenyl)methyl]-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-benzylidene-4-[(4-fluorophenyl)methyl]-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4576350 |
| Molecular Formula | C28H25FN2O2S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-benzylidene-4-[(4-fluorophenyl)methyl]-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
| SMILES | O=C(c1ccc2c(c1)N(Cc1ccc(F)cc1)C(=O)C(=Cc1ccccc1)S2)N1CCCCC1 |
| InChI | InChI=1S/C28H25FN2O2S/c29-23-12-9-21(10-13-23)19-31-24-18-22(27(32)30-15-5-2-6-16-30)11-14-25(24)34-26(28(31)33)17-20-7-3-1-4-8-20/h1,3-4,7-14,17-18H,2,5-6,15-16,19H2 |
| InChIKey | RPMGFXULMQFTKZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|