C28H26N2O2S — CID 4070489
4-[(3-methylphenyl)methyl]-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one (PubChem CID 4070489) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methyl]-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one.
| Compound Name | 4-[(3-methylphenyl)methyl]-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4070489 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-[(3-methylphenyl)methyl]-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(CN2C(=O)C(=Cc3ccc(C(=O)N4CCCC4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C28H26N2O2S/c1-20-7-6-8-22(17-20)19-30-24-9-2-3-10-25(24)33-26(28(30)32)18-21-11-13-23(14-12-21)27(31)29-15-4-5-16-29/h2-3,6-14,17-18H,4-5,15-16,19H2,1H3 |
| InChIKey | PBHUNMONOGENBK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|