C29H30N2O2S — CID 46373973
N-(3-methylbutyl)-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46373973) has the molecular formula C29H30N2O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-(3-methylbutyl)-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(3-methylbutyl)-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46373973 |
| Molecular Formula | C29H30N2O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-(3-methylbutyl)-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C\c3ccc(C(=O)NCCC(C)C)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C29H30N2O2S/c1-20(2)15-16-30-28(32)24-13-11-22(12-14-24)18-27-29(33)31(19-23-8-6-7-21(3)17-23)25-9-4-5-10-26(25)34-27/h4-14,17-18,20H,15-16,19H2,1-3H3,(H,30,32)/b27-18+ |
| InChIKey | ZNJOTXDVWQTEBS-OVVQPSECSA-N |
| XLogP | 6.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|