C32H38N3O2S+ — CID 3316264
butyl-methyl-[3-[[4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]amino]propyl]azanium (PubChem CID 3316264) has the molecular formula C32H38N3O2S+ and a molecular weight of 528.74 g/mol. Its IUPAC name is butyl-methyl-[3-[[4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]amino]propyl]azanium.
| Compound Name | butyl-methyl-[3-[[4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 3316264 |
| Molecular Formula | C32H38N3O2S+ |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | butyl-methyl-[3-[[4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]amino]propyl]azanium |
| SMILES | CCCC[NH+](C)CCCNC(=O)c1ccc(C=C2Sc3ccccc3N(Cc3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C32H37N3O2S/c1-4-5-19-34(3)20-9-18-33-31(36)27-16-14-25(15-17-27)22-30-32(37)35(23-26-11-8-10-24(2)21-26)28-12-6-7-13-29(28)38-30/h6-8,10-17,21-22H,4-5,9,18-20,23H2,1-3H3,(H,33,36)/p+1 |
| InChIKey | ZAFGANNZTRRUFT-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|