C34H41N3O2S — CID 46374402
(2Z)-2-benzylidene-N-[2-(dibutylamino)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46374402) has the molecular formula C34H41N3O2S and a molecular weight of 555.79 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[2-(dibutylamino)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[2-(dibutylamino)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46374402 |
| Molecular Formula | C34H41N3O2S |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | (2Z)-2-benzylidene-N-[2-(dibutylamino)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | CCCCN(CCCC)CCNC(=O)c1ccc2c(c1)N(Cc1cccc(C)c1)C(=O)/C(=C/c1ccccc1)S2 |
| InChI | InChI=1S/C34H41N3O2S/c1-4-6-19-36(20-7-5-2)21-18-35-33(38)29-16-17-31-30(24-29)37(25-28-15-11-12-26(3)22-28)34(39)32(40-31)23-27-13-9-8-10-14-27/h8-17,22-24H,4-7,18-21,25H2,1-3H3,(H,35,38)/b32-23- |
| InChIKey | MDSMCQWVLLPRIT-SJIPCVTESA-N |
| XLogP | 7.31 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|