C34H39N3O2S — CID 98349887
(2Z)-2-benzylidene-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 98349887) has the molecular formula C34H39N3O2S and a molecular weight of 553.77 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 98349887 |
| Molecular Formula | C34H39N3O2S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | (2Z)-2-benzylidene-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C/c3ccccc3)Sc3ccc(C(=O)NCCCN4C[C@H](C)C[C@@H](C)C4)cc32)c1 |
| InChI | InChI=1S/C34H39N3O2S/c1-24-9-7-12-28(18-24)23-37-30-20-29(33(38)35-15-8-16-36-21-25(2)17-26(3)22-36)13-14-31(30)40-32(34(37)39)19-27-10-5-4-6-11-27/h4-7,9-14,18-20,25-26H,8,15-17,21-23H2,1-3H3,(H,35,38)/b32-19-/t25-,26-/m1/s1 |
| InChIKey | ABKKAJMGWBGMKT-ZULKDDLISA-N |
| XLogP | 6.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|