C28H35N3O2S — CID 92657146
(2Z)-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-2-[(2-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 92657146) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is (2Z)-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-2-[(2-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-2-[(2-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92657146 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (2Z)-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-2-[(2-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1ccccc1/C=C1\Sc2ccc(C(=O)NCCCN3C[C@H](C)C[C@H](C)C3)cc2N(C)C1=O |
| InChI | InChI=1S/C28H35N3O2S/c1-19-14-20(2)18-31(17-19)13-7-12-29-27(32)23-10-11-25-24(15-23)30(4)28(33)26(34-25)16-22-9-6-5-8-21(22)3/h5-6,8-11,15-16,19-20H,7,12-14,17-18H2,1-4H3,(H,29,32)/b26-16-/t19-,20+ |
| InChIKey | GXZSORODJPBZCV-YWLYXACTSA-N |
| XLogP | 5.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|