C25H22ClN3O4S2 — CID 5048405
2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-1,4-benzothiazine-6-carboxamide (PubChem CID 5048405) has the molecular formula C25H22ClN3O4S2 and a molecular weight of 528.06 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5048405 |
| Molecular Formula | C25H22ClN3O4S2 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-1,4-benzothiazine-6-carboxamide |
| SMILES | CN1C(=O)C(=Cc2ccccc2Cl)Sc2ccc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)cc21 |
| InChI | InChI=1S/C25H22ClN3O4S2/c1-29-21-14-18(24(30)28-13-12-16-6-9-19(10-7-16)35(27,32)33)8-11-22(21)34-23(25(29)31)15-17-4-2-3-5-20(17)26/h2-11,14-15H,12-13H2,1H3,(H,28,30)(H2,27,32,33) |
| InChIKey | BGFGPFSHUOVGMC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|