C26H23ClN2O2S — CID 46250207
(2Z)-2-[(3-chlorophenyl)methylidene]-4-methyl-N-[2-(4-methylphenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46250207) has the molecular formula C26H23ClN2O2S and a molecular weight of 463.00 g/mol. Its IUPAC name is (2Z)-2-[(3-chlorophenyl)methylidene]-4-methyl-N-[2-(4-methylphenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-[(3-chlorophenyl)methylidene]-4-methyl-N-[2-(4-methylphenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46250207 |
| Molecular Formula | C26H23ClN2O2S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (2Z)-2-[(3-chlorophenyl)methylidene]-4-methyl-N-[2-(4-methylphenyl)ethyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2ccc3c(c2)N(C)C(=O)/C(=C/c2cccc(Cl)c2)S3)cc1 |
| InChI | InChI=1S/C26H23ClN2O2S/c1-17-6-8-18(9-7-17)12-13-28-25(30)20-10-11-23-22(16-20)29(2)26(31)24(32-23)15-19-4-3-5-21(27)14-19/h3-11,14-16H,12-13H2,1-2H3,(H,28,30)/b24-15- |
| InChIKey | NFPUJWJYLJPAKR-IWIPYMOSSA-N |
| XLogP | 5.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|