C28H28N2O2S — CID 92657127
(2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2S)-4-phenylbutan-2-yl]-1,4-benzothiazine-6-carboxamide (PubChem CID 92657127) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2S)-4-phenylbutan-2-yl]-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2S)-4-phenylbutan-2-yl]-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92657127 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2S)-4-phenylbutan-2-yl]-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(/C=C2\Sc3ccc(C(=O)N[C@@H](C)CCc4ccccc4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C28H28N2O2S/c1-19-8-7-11-22(16-19)17-26-28(32)30(3)24-18-23(14-15-25(24)33-26)27(31)29-20(2)12-13-21-9-5-4-6-10-21/h4-11,14-18,20H,12-13H2,1-3H3,(H,29,31)/b26-17-/t20-/m0/s1 |
| InChIKey | IZEWMGPTLOQHPC-WFSKJOQISA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|