C27H26N2O2S — CID 92667046
(2E)-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2R)-4-phenylbutan-2-yl]-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92667046) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2R)-4-phenylbutan-2-yl]-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2R)-4-phenylbutan-2-yl]-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92667046 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-N-[(2R)-4-phenylbutan-2-yl]-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(/C=C2/Sc3ccc(C(=O)N[C@H](C)CCc4ccccc4)cc3NC2=O)c1 |
| InChI | InChI=1S/C27H26N2O2S/c1-18-7-6-10-21(15-18)16-25-27(31)29-23-17-22(13-14-24(23)32-25)26(30)28-19(2)11-12-20-8-4-3-5-9-20/h3-10,13-17,19H,11-12H2,1-2H3,(H,28,30)(H,29,31)/b25-16+/t19-/m1/s1 |
| InChIKey | VFCLEKPISQOCAY-DUYBAWCLSA-N |
| XLogP | 5.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|