C25H22N2O2S2 — CID 6256870
(2Z)-2-benzylidene-N-[2-(4-methylsulfanylphenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 6256870) has the molecular formula C25H22N2O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[2-(4-methylsulfanylphenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[2-(4-methylsulfanylphenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6256870 |
| Molecular Formula | C25H22N2O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2Z)-2-benzylidene-N-[2-(4-methylsulfanylphenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CSc1ccc(CCNC(=O)c2ccc3c(c2)NC(=O)/C(=C/c2ccccc2)S3)cc1 |
| InChI | InChI=1S/C25H22N2O2S2/c1-30-20-10-7-17(8-11-20)13-14-26-24(28)19-9-12-22-21(16-19)27-25(29)23(31-22)15-18-5-3-2-4-6-18/h2-12,15-16H,13-14H2,1H3,(H,26,28)(H,27,29)/b23-15- |
| InChIKey | GNTMNBIHROXJCZ-HAHDFKILSA-N |
| XLogP | 5.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|