C25H21ClN2O3S — CID 46373841
(2E)-N-[2-(4-chlorophenyl)ethyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46373841) has the molecular formula C25H21ClN2O3S and a molecular weight of 464.97 g/mol. Its IUPAC name is (2E)-N-[2-(4-chlorophenyl)ethyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[2-(4-chlorophenyl)ethyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46373841 |
| Molecular Formula | C25H21ClN2O3S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (2E)-N-[2-(4-chlorophenyl)ethyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1cccc(/C=C2/Sc3ccc(C(=O)NCCc4ccc(Cl)cc4)cc3NC2=O)c1 |
| InChI | InChI=1S/C25H21ClN2O3S/c1-31-20-4-2-3-17(13-20)14-23-25(30)28-21-15-18(7-10-22(21)32-23)24(29)27-12-11-16-5-8-19(26)9-6-16/h2-10,13-15H,11-12H2,1H3,(H,27,29)(H,28,30)/b23-14+ |
| InChIKey | XLGUGIFKQCIRER-OEAKJJBVSA-N |
| XLogP | 5.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|