C23H26N2O5S — CID 46373831
(2E)-N-(2,2-diethoxyethyl)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46373831) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is (2E)-N-(2,2-diethoxyethyl)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-(2,2-diethoxyethyl)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46373831 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2E)-N-(2,2-diethoxyethyl)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCOC(CNC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1cccc(OC)c1)S2)OCC |
| InChI | InChI=1S/C23H26N2O5S/c1-4-29-21(30-5-2)14-24-22(26)16-9-10-19-18(13-16)25-23(27)20(31-19)12-15-7-6-8-17(11-15)28-3/h6-13,21H,4-5,14H2,1-3H3,(H,24,26)(H,25,27)/b20-12+ |
| InChIKey | BKGDFFKSUVHHIB-UDWIEESQSA-N |
| XLogP | 3.91 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|