C24H19FN2O3S — CID 3401717
N-[(4-fluorophenyl)methyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 3401717) has the molecular formula C24H19FN2O3S and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 3401717 |
| Molecular Formula | C24H19FN2O3S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1cccc(C=C2Sc3ccc(C(=O)NCc4ccc(F)cc4)cc3NC2=O)c1 |
| InChI | InChI=1S/C24H19FN2O3S/c1-30-19-4-2-3-16(11-19)12-22-24(29)27-20-13-17(7-10-21(20)31-22)23(28)26-14-15-5-8-18(25)9-6-15/h2-13H,14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | MROXXQBRPPTZDA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|