C24H20N2O3S — CID 6262415
(2E)-N-benzyl-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 6262415) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is (2E)-N-benzyl-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-benzyl-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6262415 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2E)-N-benzyl-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(/C=C2/Sc3ccc(C(=O)NCc4ccccc4)cc3NC2=O)cc1 |
| InChI | InChI=1S/C24H20N2O3S/c1-29-19-10-7-16(8-11-19)13-22-24(28)26-20-14-18(9-12-21(20)30-22)23(27)25-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,25,27)(H,26,28)/b22-13+ |
| InChIKey | QHYPNRACFJVYHB-LPYMAVHISA-N |
| XLogP | 4.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|