C23H17FN2O2S — CID 3485358
N-[(4-fluorophenyl)methyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide (PubChem CID 3485358) has the molecular formula C23H17FN2O2S and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 3485358 |
| Molecular Formula | C23H17FN2O2S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide |
| SMILES | O=C1Nc2ccccc2SC1=Cc1ccc(C(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H17FN2O2S/c24-18-11-7-16(8-12-18)14-25-22(27)17-9-5-15(6-10-17)13-21-23(28)26-19-3-1-2-4-20(19)29-21/h1-13H,14H2,(H,25,27)(H,26,28) |
| InChIKey | QGSZLFBGJCUVBK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|