C26H26N3O2S+ — CID 4228185
benzyl-methyl-[2-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]ethyl]azanium (PubChem CID 4228185) has the molecular formula C26H26N3O2S+ and a molecular weight of 444.58 g/mol. Its IUPAC name is benzyl-methyl-[2-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]ethyl]azanium.
| Compound Name | benzyl-methyl-[2-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 4228185 |
| Molecular Formula | C26H26N3O2S+ |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | benzyl-methyl-[2-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]ethyl]azanium |
| SMILES | C[NH+](CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H25N3O2S/c1-29(18-20-7-3-2-4-8-20)16-15-27-25(30)21-13-11-19(12-14-21)17-24-26(31)28-22-9-5-6-10-23(22)32-24/h2-14,17H,15-16,18H2,1H3,(H,27,30)(H,28,31)/p+1 |
| InChIKey | GCKKDLUNEIEJOT-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|