C21H16N2O2S2 — CID 4073346
4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 4073346) has the molecular formula C21H16N2O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4073346 |
| Molecular Formula | C21H16N2O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C1Nc2ccccc2SC1=Cc1ccc(C(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C21H16N2O2S2/c24-20(22-13-16-4-3-11-26-16)15-9-7-14(8-10-15)12-19-21(25)23-17-5-1-2-6-18(17)27-19/h1-12H,13H2,(H,22,24)(H,23,25) |
| InChIKey | QOYYVOSFJOGWQP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|