C16H13NOS — CID 4278965
2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 4278965) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4278965 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ccc(C=C2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C16H13NOS/c1-11-6-8-12(9-7-11)10-15-16(18)17-13-4-2-3-5-14(13)19-15/h2-10H,1H3,(H,17,18) |
| InChIKey | DOUWJSBULVQEQA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|