C21H18N2OS — CID 126103856
(2Z)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126103856) has the molecular formula C21H18N2OS and a molecular weight of 346.45 g/mol. Its IUPAC name is (2Z)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126103856 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2Z)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cc(/C=C2\Sc3ccccc3NC2=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2OS/c1-14-12-16(15(2)23(14)17-8-4-3-5-9-17)13-20-21(24)22-18-10-6-7-11-19(18)25-20/h3-13H,1-2H3,(H,22,24)/b20-13- |
| InChIKey | IUIIQXVWWFEROG-MOSHPQCFSA-N |
| XLogP | 5.18 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|