C21H16BrNOS — CID 6514498
(2Z)-2-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-benzothiophen-3-one (PubChem CID 6514498) has the molecular formula C21H16BrNOS and a molecular weight of 410.34 g/mol. Its IUPAC name is (2Z)-2-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 6514498 |
| Molecular Formula | C21H16BrNOS |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | (2Z)-2-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-benzothiophen-3-one |
| SMILES | Cc1cc(/C=C2\Sc3ccccc3C2=O)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrNOS/c1-13-11-15(14(2)23(13)17-9-7-16(22)8-10-17)12-20-21(24)18-5-3-4-6-19(18)25-20/h3-12H,1-2H3/b20-12- |
| InChIKey | FKBZDOMSFYILAX-NDENLUEZSA-N |
| XLogP | 6.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|