C21H18N2O — CID 964191
(3E)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-1H-indol-2-one (PubChem CID 964191) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is (3E)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 964191 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3E)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(/C=C2/C(=O)Nc3ccccc32)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2O/c1-14-12-16(15(2)23(14)17-8-4-3-5-9-17)13-19-18-10-6-7-11-20(18)22-21(19)24/h3-13H,1-2H3,(H,22,24)/b19-13+ |
| InChIKey | GYLLAYYAERSMGO-CPNJWEJPSA-N |
| XLogP | 4.59 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|