C21H16ClN3O3 — CID 21370109
(3E)-6-chloro-3-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 21370109) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is (3E)-6-chloro-3-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 21370109 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (3E)-6-chloro-3-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(/C=C2/C(=O)Nc3cc(Cl)ccc32)c(C)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16ClN3O3/c1-12-9-14(10-19-18-8-3-15(22)11-20(18)23-21(19)26)13(2)24(12)16-4-6-17(7-5-16)25(27)28/h3-11H,1-2H3,(H,23,26)/b19-10+ |
| InChIKey | LKJULJOAWLCTAQ-VXLYETTFSA-N |
| XLogP | 5.15 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|