C23H20BrClN2O — CID 21370141
(3E)-3-[[1-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-chloro-1H-indol-2-one (PubChem CID 21370141) has the molecular formula C23H20BrClN2O and a molecular weight of 455.78 g/mol. Its IUPAC name is (3E)-3-[[1-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-chloro-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-chloro-1H-indol-2-one |
|---|---|
| PubChem CID | 21370141 |
| Molecular Formula | C23H20BrClN2O |
| Molecular Weight | 455.78 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (3E)-3-[[1-(4-bromo-3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-chloro-1H-indol-2-one |
| SMILES | Cc1cc(-n2c(C)cc(/C=C3/C(=O)Nc4cc(Cl)ccc43)c2C)cc(C)c1Br |
| InChI | InChI=1S/C23H20BrClN2O/c1-12-7-18(8-13(2)22(12)24)27-14(3)9-16(15(27)4)10-20-19-6-5-17(25)11-21(19)26-23(20)28/h5-11H,1-4H3,(H,26,28)/b20-10+ |
| InChIKey | CUSFCHLTDOWWFN-KEBDBYFISA-N |
| XLogP | 6.62 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|