C21H15Cl3N2O — CID 21370127
(3E)-6-chloro-3-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 21370127) has the molecular formula C21H15Cl3N2O and a molecular weight of 417.72 g/mol. Its IUPAC name is (3E)-6-chloro-3-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 21370127 |
| Molecular Formula | C21H15Cl3N2O |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | (3E)-6-chloro-3-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(/C=C2/C(=O)Nc3cc(Cl)ccc32)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H15Cl3N2O/c1-11-5-13(12(2)26(11)17-8-15(23)7-16(24)9-17)6-19-18-4-3-14(22)10-20(18)25-21(19)27/h3-10H,1-2H3,(H,25,27)/b19-6+ |
| InChIKey | FGIYHHBNJNADKC-KPSZGOFPSA-N |
| XLogP | 6.55 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|