C15H8Cl3NO2 — CID 72710618
(3E)-6-chloro-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 72710618) has the molecular formula C15H8Cl3NO2 and a molecular weight of 340.59 g/mol. Its IUPAC name is (3E)-6-chloro-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 72710618 |
| Molecular Formula | C15H8Cl3NO2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | (3E)-6-chloro-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2/C1=C\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl3NO2/c16-8-1-2-9-10(15(21)19-13(9)6-8)3-7-4-11(17)14(20)12(18)5-7/h1-6,20H,(H,19,21)/b10-3+ |
| InChIKey | IOWSRTVHVZCDTG-XCVCLJGOSA-N |
| XLogP | 4.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|