C16H8Cl2F3NO2 — CID 126107167
(3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126107167) has the molecular formula C16H8Cl2F3NO2 and a molecular weight of 374.15 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126107167 |
| Molecular Formula | C16H8Cl2F3NO2 |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2/C1=C/c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2F3NO2/c17-11-4-7(5-12(18)14(11)23)3-10-9-2-1-8(16(19,20)21)6-13(9)22-15(10)24/h1-6,23H,(H,22,24)/b10-3- |
| InChIKey | WZJYPTWJIFLZJK-KMKOMSMNSA-N |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|