C16H9F4NO — CID 955415
(3Z)-3-[(2-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 955415) has the molecular formula C16H9F4NO and a molecular weight of 307.25 g/mol. Its IUPAC name is (3Z)-3-[(2-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(2-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 955415 |
| Molecular Formula | C16H9F4NO |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (3Z)-3-[(2-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2/C1=C/c1ccccc1F |
| InChI | InChI=1S/C16H9F4NO/c17-13-4-2-1-3-9(13)7-12-11-6-5-10(16(18,19)20)8-14(11)21-15(12)22/h1-8H,(H,21,22)/b12-7- |
| InChIKey | HNOBVSPQPGFTOD-GHXNOFRVSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|