C24H18F3NO2 — CID 126110677
(3Z)-3-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126110677) has the molecular formula C24H18F3NO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is (3Z)-3-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126110677 |
| Molecular Formula | C24H18F3NO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (3Z)-3-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | Cc1cccc(COc2ccccc2/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C24H18F3NO2/c1-15-5-4-6-16(11-15)14-30-22-8-3-2-7-17(22)12-20-19-10-9-18(24(25,26)27)13-21(19)28-23(20)29/h2-13H,14H2,1H3,(H,28,29)/b20-12- |
| InChIKey | DBCDRSQGDPLVSL-NDENLUEZSA-N |
| XLogP | 6.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|