C25H16BrF3N2O3 — CID 124541027
2-[[5-bromo-2-methoxy-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 124541027) has the molecular formula C25H16BrF3N2O3 and a molecular weight of 529.31 g/mol. Its IUPAC name is 2-[[5-bromo-2-methoxy-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[5-bromo-2-methoxy-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124541027 |
| Molecular Formula | C25H16BrF3N2O3 |
| Molecular Weight | 529.31 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[[5-bromo-2-methoxy-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H16BrF3N2O3/c1-33-22-9-16(20(26)11-23(22)34-13-15-5-3-2-4-14(15)12-30)8-19-18-7-6-17(25(27,28)29)10-21(18)31-24(19)32/h2-11H,13H2,1H3,(H,31,32)/b19-8- |
| InChIKey | BKUYQCLLSAJILM-UWVJOHFNSA-N |
| XLogP | 6.42 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.31 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|