C24H15BrCl2F3NO3 — CID 126104629
(3Z)-3-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126104629) has the molecular formula C24H15BrCl2F3NO3 and a molecular weight of 573.19 g/mol. Its IUPAC name is (3Z)-3-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126104629 |
| Molecular Formula | C24H15BrCl2F3NO3 |
| Molecular Weight | 573.19 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | (3Z)-3-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15BrCl2F3NO3/c1-33-21-7-13(18(25)10-22(21)34-11-12-2-4-15(26)9-19(12)27)6-17-16-5-3-14(24(28,29)30)8-20(16)31-23(17)32/h2-10H,11H2,1H3,(H,31,32)/b17-6- |
| InChIKey | OFGHFACCQUWYFF-FMQZQXMHSA-N |
| XLogP | 7.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.19 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|