C25H19ClF3NO4 — CID 21374160
(3E)-3-[[4-[2-(4-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374160) has the molecular formula C25H19ClF3NO4 and a molecular weight of 489.88 g/mol. Its IUPAC name is (3E)-3-[[4-[2-(4-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[4-[2-(4-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374160 |
| Molecular Formula | C25H19ClF3NO4 |
| Molecular Weight | 489.88 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (3E)-3-[[4-[2-(4-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | COc1cc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)ccc1OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClF3NO4/c1-32-23-13-15(2-9-22(23)34-11-10-33-18-6-4-17(26)5-7-18)12-20-19-8-3-16(25(27,28)29)14-21(19)30-24(20)31/h2-9,12-14H,10-11H2,1H3,(H,30,31)/b20-12+ |
| InChIKey | JFOHVMKRFSXOQE-UDWIEESQSA-N |
| XLogP | 6.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.88 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|