C21H19BrF3NO3 — CID 21374163
(3E)-3-[(2-bromo-4-butoxy-5-methoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374163) has the molecular formula C21H19BrF3NO3 and a molecular weight of 470.29 g/mol. Its IUPAC name is (3E)-3-[(2-bromo-4-butoxy-5-methoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(2-bromo-4-butoxy-5-methoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374163 |
| Molecular Formula | C21H19BrF3NO3 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | (3E)-3-[(2-bromo-4-butoxy-5-methoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CCCCOc1cc(Br)c(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)cc1OC |
| InChI | InChI=1S/C21H19BrF3NO3/c1-3-4-7-29-19-11-16(22)12(9-18(19)28-2)8-15-14-6-5-13(21(23,24)25)10-17(14)26-20(15)27/h5-6,8-11H,3-4,7H2,1-2H3,(H,26,27)/b15-8+ |
| InChIKey | ITVHNXSWNXNART-OVCLIPMQSA-N |
| XLogP | 6.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|