C20H18F3NO2 — CID 21373979
(3E)-3-[(4-butoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21373979) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is (3E)-3-[(4-butoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(4-butoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21373979 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (3E)-3-[(4-butoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CCCCOc1ccc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C20H18F3NO2/c1-2-3-10-26-15-7-4-13(5-8-15)11-17-16-9-6-14(20(21,22)23)12-18(16)24-19(17)25/h4-9,11-12H,2-3,10H2,1H3,(H,24,25)/b17-11+ |
| InChIKey | HZTSYKFLVMFFRT-GZTJUZNOSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|