C23H24F3NO2 — CID 54490013
3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 54490013) has the molecular formula C23H24F3NO2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 54490013 |
| Molecular Formula | C23H24F3NO2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | COc1c(C(C)C)cc(C=C2C(=O)Nc3cc(C(F)(F)F)ccc32)cc1C(C)C |
| InChI | InChI=1S/C23H24F3NO2/c1-12(2)17-8-14(9-18(13(3)4)21(17)29-5)10-19-16-7-6-15(23(24,25)26)11-20(16)27-22(19)28/h6-13H,1-5H3,(H,27,28) |
| InChIKey | XVAPTBXVXIUUOK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|