C21H17ClF3NO3 — CID 126105013
(3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126105013) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126105013 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)cc1OCC |
| InChI | InChI=1S/C21H17ClF3NO3/c1-3-7-29-19-16(22)9-12(10-18(19)28-4-2)8-15-14-6-5-13(21(23,24)25)11-17(14)26-20(15)27/h3,5-6,8-11H,1,4,7H2,2H3,(H,26,27)/b15-8- |
| InChIKey | RBGARWLNSGSZRZ-NVNXTCNLSA-N |
| XLogP | 5.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|