C24H19ClFNO3 — CID 4297775
3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 4297775) has the molecular formula C24H19ClFNO3 and a molecular weight of 423.87 g/mol. Its IUPAC name is 3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 4297775 |
| Molecular Formula | C24H19ClFNO3 |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | CCOc1cc(C=C2C(=O)Nc3ccccc32)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C24H19ClFNO3/c1-2-29-22-13-16(11-19-18-8-3-4-9-21(18)27-24(19)28)12-20(25)23(22)30-14-15-6-5-7-17(26)10-15/h3-13H,2,14H2,1H3,(H,27,28) |
| InChIKey | PYHWFQGVTMJSSN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|