C25H18Cl2F3NO3 — CID 126108205
(3Z)-3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126108205) has the molecular formula C25H18Cl2F3NO3 and a molecular weight of 508.32 g/mol. Its IUPAC name is (3Z)-3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126108205 |
| Molecular Formula | C25H18Cl2F3NO3 |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | (3Z)-3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CCOc1cc(/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18Cl2F3NO3/c1-2-33-22-11-15(10-20(27)23(22)34-13-14-3-6-17(26)7-4-14)9-19-18-8-5-16(25(28,29)30)12-21(18)31-24(19)32/h3-12H,2,13H2,1H3,(H,31,32)/b19-9- |
| InChIKey | ZDCKUSIWGNZERJ-OCKHKDLRSA-N |
| XLogP | 7.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|