C25H19ClF3NO3 — CID 21374036
(3E)-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374036) has the molecular formula C25H19ClF3NO3 and a molecular weight of 473.88 g/mol. Its IUPAC name is (3E)-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374036 |
| Molecular Formula | C25H19ClF3NO3 |
| Molecular Weight | 473.88 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (3E)-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CCOc1cc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClF3NO3/c1-2-32-23-12-16(5-10-22(23)33-14-15-3-7-18(26)8-4-15)11-20-19-9-6-17(25(27,28)29)13-21(19)30-24(20)31/h3-13H,2,14H2,1H3,(H,30,31)/b20-11+ |
| InChIKey | STZJJBUZJBFSIM-RGVLZGJSSA-N |
| XLogP | 6.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.88 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|